Products 299970-56-2
CAS 299970-56-2 is the registry number for (E)-2-((2-(Benzo(D)thiazol-2-yl)hydrazineylidene)methyl)-4-nitrophenol. Offered by: Biosynth. Available pack sizes: 25mg, 50mg.
2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-nitrophenol (CAS 299970-56-2) is a chemical compound with the molecular formula C14H10N4O3S and a molecular weight of 314.32 g/mol. IUPAC name: 2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-nitrophenol. InChIKey: NOFFSRRCQHABEJ-NVNXTCNLSA-N.
| Molecular formula | C14H10N4O3S |
|---|---|
| Molecular weight | 314.32 g/mol |
| IUPAC name | 2-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-4-nitrophenol |
| InChIKey | NOFFSRRCQHABEJ-NVNXTCNLSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)N/N=C\C3=C(C=CC(=C3)[N+](=O)[O-])O |
Computed by PubChem (NCBI)