Products 3000549-26-5
CAS 3000549-26-5 appears in our catalog under these names: OICR-8268, 99.23%, OICR-8268, 98%. Offered by: MedChemExpress, Ambeed. Available pack sizes: 100 mg, 10mM/1mL, 50 mg, 5 mg, 25 mg, 10 mg, 10mg, 25mg.
N-[(1S)-3-amino-1-(3-chloro-4-fluorophenyl)-3-oxopropyl]-5-(4-chloro-2-fluorophenyl)-1H-pyrazole-4-carboxamide (CAS 3000549-26-5) is a chemical compound with the molecular formula C19H14Cl2F2N4O2 and a molecular weight of 439.2 g/mol. IUPAC name: N-[(1S)-3-amino-1-(3-chloro-4-fluorophenyl)-3-oxopropyl]-5-(4-chloro-2-fluorophenyl)-1H-pyrazole-4-carboxamide. InChIKey: IPDMIUDPUBUHSU-INIZCTEOSA-N.
| Molecular formula | C19H14Cl2F2N4O2 |
|---|---|
| Molecular weight | 439.2 g/mol |
| IUPAC name | N-[(1S)-3-amino-1-(3-chloro-4-fluorophenyl)-3-oxopropyl]-5-(4-chloro-2-fluorophenyl)-1H-pyrazole-4-carboxamide |
| InChIKey | IPDMIUDPUBUHSU-INIZCTEOSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](CC(=O)N)NC(=O)C2=C(NN=C2)C3=C(C=C(C=C3)Cl)F)Cl)F |
Computed by PubChem (NCBI)