CAS 3002069-20-4 is the registry number for DHFR-IN-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[2-(2,4-dichlorophenyl)-4,5-diphenylimidazol-1-yl]phenyl]-phenyldiazene (CAS 3002069-20-4) is a chemical compound with the molecular formula C33H22Cl2N4 and a molecular weight of 545.5 g/mol. IUPAC name: [4-[2-(2,4-dichlorophenyl)-4,5-diphenylimidazol-1-yl]phenyl]-phenyldiazene. InChIKey: UDDBBDZNBYWZTH-UHFFFAOYSA-N.
| Molecular formula | C33H22Cl2N4 |
|---|---|
| Molecular weight | 545.5 g/mol |
| IUPAC name | [4-[2-(2,4-dichlorophenyl)-4,5-diphenylimidazol-1-yl]phenyl]-phenyldiazene |
| InChIKey | UDDBBDZNBYWZTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N(C(=N2)C3=C(C=C(C=C3)Cl)Cl)C4=CC=C(C=C4)N=NC5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)