Products 3002426-04-9
CAS 3002426-04-9 is the registry number for 2,2,2-trifluoro-1-(5-methylbenzo[b]thiophen-2-yl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2,2-trifluoro-1-(5-methyl-1-benzothiophen-2-yl)ethanone (CAS 3002426-04-9) is a chemical compound with the molecular formula C11H7F3OS and a molecular weight of 244.23 g/mol. IUPAC name: 2,2,2-trifluoro-1-(5-methyl-1-benzothiophen-2-yl)ethanone. InChIKey: ADJAXFJGRSNTDY-UHFFFAOYSA-N.
| Molecular formula | C11H7F3OS |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(5-methyl-1-benzothiophen-2-yl)ethanone |
| InChIKey | ADJAXFJGRSNTDY-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC(=C2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)