CAS 3002429-71-9 is the registry number for 1,2-bis(2-bromo-4,6-difluorophenoxy)ethane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-[2-(2-bromo-4,6-difluorophenoxy)ethoxy]-3,5-difluorobenzene (CAS 3002429-71-9) is a chemical compound with the molecular formula C14H8Br2F4O2 and a molecular weight of 444.01 g/mol. IUPAC name: 1-bromo-2-[2-(2-bromo-4,6-difluorophenoxy)ethoxy]-3,5-difluorobenzene. InChIKey: HDRIWTUKSFSVNI-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2F4O2 |
|---|---|
| Molecular weight | 444.01 g/mol |
| IUPAC name | 1-bromo-2-[2-(2-bromo-4,6-difluorophenoxy)ethoxy]-3,5-difluorobenzene |
| InChIKey | HDRIWTUKSFSVNI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)OCCOC2=C(C=C(C=C2Br)F)F)Br)F |
Computed by PubChem (NCBI)