Products 3002435-83-5
CAS 3002435-83-5 is the registry number for 2-bromo-4-(tert-butyl)-1-((4-methoxybenzyl)oxy)benzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-4-tert-butyl-1-[(4-methoxyphenyl)methoxy]benzene (CAS 3002435-83-5) is a chemical compound with the molecular formula C18H21BrO2 and a molecular weight of 349.3 g/mol. IUPAC name: 2-bromo-4-tert-butyl-1-[(4-methoxyphenyl)methoxy]benzene. InChIKey: FFFHEZFKIGDHHT-UHFFFAOYSA-N.
| Molecular formula | C18H21BrO2 |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | 2-bromo-4-tert-butyl-1-[(4-methoxyphenyl)methoxy]benzene |
| InChIKey | FFFHEZFKIGDHHT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OCC2=CC=C(C=C2)OC)Br |
Computed by PubChem (NCBI)