Products 3002439-88-2
CAS 3002439-88-2 is the registry number for 2-(5-bromo-2-fluoro-3-methylphenyl)-2-(trifluoromethyl)-1,3-dioxane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(5-bromo-2-fluoro-3-methylphenyl)-2-(trifluoromethyl)-1,3-dioxane (CAS 3002439-88-2) is a chemical compound with the molecular formula C12H11BrF4O2 and a molecular weight of 343.11 g/mol. IUPAC name: 2-(5-bromo-2-fluoro-3-methylphenyl)-2-(trifluoromethyl)-1,3-dioxane. InChIKey: UIQJOIABBMWQSP-UHFFFAOYSA-N.
| Molecular formula | C12H11BrF4O2 |
|---|---|
| Molecular weight | 343.11 g/mol |
| IUPAC name | 2-(5-bromo-2-fluoro-3-methylphenyl)-2-(trifluoromethyl)-1,3-dioxane |
| InChIKey | UIQJOIABBMWQSP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C2(OCCCO2)C(F)(F)F)Br |
Computed by PubChem (NCBI)