Products 3002439-94-0
CAS 3002439-94-0 is the registry number for 2-(2-fluoro-5-methyl-3-(methylthio)phenyl)propan-2-ol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-fluoro-5-methyl-3-methylsulfanylphenyl)propan-2-ol (CAS 3002439-94-0) is a chemical compound with the molecular formula C11H15FOS and a molecular weight of 214.30 g/mol. IUPAC name: 2-(2-fluoro-5-methyl-3-methylsulfanylphenyl)propan-2-ol. InChIKey: SWPFWGYFEQIUNZ-UHFFFAOYSA-N.
| Molecular formula | C11H15FOS |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | 2-(2-fluoro-5-methyl-3-methylsulfanylphenyl)propan-2-ol |
| InChIKey | SWPFWGYFEQIUNZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)SC)F)C(C)(C)O |
Computed by PubChem (NCBI)