CAS 3002448-59-8 is the registry number for 1-(4'-ethyl-[1,1'-biphenyl]-4-yl)-2,2,2-trifluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[4-(4-ethylphenyl)phenyl]-2,2,2-trifluoroethanone (CAS 3002448-59-8) is a chemical compound with the molecular formula C16H13F3O and a molecular weight of 278.27 g/mol. IUPAC name: 1-[4-(4-ethylphenyl)phenyl]-2,2,2-trifluoroethanone. InChIKey: ISHPXJNCPWLXPU-UHFFFAOYSA-N.
| Molecular formula | C16H13F3O |
|---|---|
| Molecular weight | 278.27 g/mol |
| IUPAC name | 1-[4-(4-ethylphenyl)phenyl]-2,2,2-trifluoroethanone |
| InChIKey | ISHPXJNCPWLXPU-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)