CAS 3002473-49-3 is the registry number for 1-(5-bromobenzofuran-2-yl)-2,2,3,3,3-pentafluoropropan-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(5-bromo-1-benzofuran-2-yl)-2,2,3,3,3-pentafluoropropan-1-one (CAS 3002473-49-3) is a chemical compound with the molecular formula C11H4BrF5O2 and a molecular weight of 343.04 g/mol. IUPAC name: 1-(5-bromo-1-benzofuran-2-yl)-2,2,3,3,3-pentafluoropropan-1-one. InChIKey: DPCZKZALXBUBTA-UHFFFAOYSA-N.
| Molecular formula | C11H4BrF5O2 |
|---|---|
| Molecular weight | 343.04 g/mol |
| IUPAC name | 1-(5-bromo-1-benzofuran-2-yl)-2,2,3,3,3-pentafluoropropan-1-one |
| InChIKey | DPCZKZALXBUBTA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C=C(O2)C(=O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)