CAS 3002477-15-5 is the registry number for 2,2-dichloro-1-(2-fluoro-3-(trifluoromethyl)phenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,2-dichloro-1-[2-fluoro-3-(trifluoromethyl)phenyl]ethanone (CAS 3002477-15-5) is a chemical compound with the molecular formula C9H4Cl2F4O and a molecular weight of 275.02 g/mol. IUPAC name: 2,2-dichloro-1-[2-fluoro-3-(trifluoromethyl)phenyl]ethanone. InChIKey: GEOIQJVMBMUXGU-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2F4O |
|---|---|
| Molecular weight | 275.02 g/mol |
| IUPAC name | 2,2-dichloro-1-[2-fluoro-3-(trifluoromethyl)phenyl]ethanone |
| InChIKey | GEOIQJVMBMUXGU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)C(=O)C(Cl)Cl |
Computed by PubChem (NCBI)