Products 3002478-04-5
CAS 3002478-04-5 is the registry number for 6-(ethylthio)-2-fluoronicotinic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-ethylsulfanyl-2-fluoropyridine-3-carboxylic acid (CAS 3002478-04-5) is a chemical compound with the molecular formula C8H8FNO2S and a molecular weight of 201.22 g/mol. IUPAC name: 6-ethylsulfanyl-2-fluoropyridine-3-carboxylic acid. InChIKey: VQDNPFUSQYENAE-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO2S |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 6-ethylsulfanyl-2-fluoropyridine-3-carboxylic acid |
| InChIKey | VQDNPFUSQYENAE-UHFFFAOYSA-N |
| SMILES | CCSC1=NC(=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
6-(ethylthio)-2-fluoronicotinic acid