Products 3002478-40-9
CAS 3002478-40-9 is the registry number for (3-chloro-2-fluoropyridin-4-yl)(cyclohexyl)methanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3-chloro-2-fluoro-4-pyridinyl)-cyclohexylmethanone (CAS 3002478-40-9) is a chemical compound with the molecular formula C12H13ClFNO and a molecular weight of 241.69 g/mol. IUPAC name: (3-chloro-2-fluoro-4-pyridinyl)-cyclohexylmethanone. InChIKey: WWORTLNMKITWOO-UHFFFAOYSA-N.
| Molecular formula | C12H13ClFNO |
|---|---|
| Molecular weight | 241.69 g/mol |
| IUPAC name | (3-chloro-2-fluoro-4-pyridinyl)-cyclohexylmethanone |
| InChIKey | WWORTLNMKITWOO-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)C2=C(C(=NC=C2)F)Cl |
Computed by PubChem (NCBI)