Products 3002499-60-4
CAS 3002499-60-4 is the registry number for 1-(6-bromo-2-fluoro-3-methoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(6-bromo-2-fluoro-3-methoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-one (CAS 3002499-60-4) is a chemical compound with the molecular formula C10H5BrF6O2 and a molecular weight of 351.04 g/mol. IUPAC name: 1-(6-bromo-2-fluoro-3-methoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-one. InChIKey: JLZNNZWQQKAJCE-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF6O2 |
|---|---|
| Molecular weight | 351.04 g/mol |
| IUPAC name | 1-(6-bromo-2-fluoro-3-methoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-one |
| InChIKey | JLZNNZWQQKAJCE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)C(=O)C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)