Products 3002520-70-6
CAS 3002520-70-6 is the registry number for (6-bromo-2-fluoro-3-methoxyphenyl)(p-tolyl)methanol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(6-bromo-2-fluoro-3-methoxyphenyl)-(4-methylphenyl)methanol (CAS 3002520-70-6) is a chemical compound with the molecular formula C15H14BrFO2 and a molecular weight of 325.17 g/mol. IUPAC name: (6-bromo-2-fluoro-3-methoxyphenyl)-(4-methylphenyl)methanol. InChIKey: UNKGGVULSUDKFM-UHFFFAOYSA-N.
| Molecular formula | C15H14BrFO2 |
|---|---|
| Molecular weight | 325.17 g/mol |
| IUPAC name | (6-bromo-2-fluoro-3-methoxyphenyl)-(4-methylphenyl)methanol |
| InChIKey | UNKGGVULSUDKFM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=C(C=CC(=C2F)OC)Br)O |
Computed by PubChem (NCBI)