CAS 300347-38-0 is the registry number for 2,4-dimethoxy-1-(2-(1-methyl(2-pyridyl))vinyl)benzene, iodide. Offered by: Biosynth. Available pack sizes: 5000mg.
2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide (CAS 300347-38-0) is a chemical compound with the molecular formula C16H18INO2 and a molecular weight of 383.22 g/mol. IUPAC name: 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide. InChIKey: PWUDCAXPBZYSRD-BXTVWIJMSA-M.
| Molecular formula | C16H18INO2 |
|---|---|
| Molecular weight | 383.22 g/mol |
| IUPAC name | 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide |
| InChIKey | PWUDCAXPBZYSRD-BXTVWIJMSA-M |
| SMILES | C[N+]1=CC=CC=C1/C=C/C2=C(C=C(C=C2)OC)OC.[I-] |
Computed by PubChem (NCBI)