CAS 30044-61-2 appears in our catalog under these names: Boc-Cys(stbu)-OH, 97%, Boc–Cys(StBu)–OH, Boc-L-Cys(StBu)-OH, Boc-S-tert-butylthio-L-cysteine, BOC-CYS(STBU)-OH, >=99.0%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 10g, 100mg, 250mg.
(2R)-3-(tert-butyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 30044-61-2) is a chemical compound with the molecular formula C12H23NO4S2 and a molecular weight of 309.5 g/mol. IUPAC name: (2R)-3-(tert-butyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PPQRALRLGBAWHD-QMMMGPOBSA-N.
| Molecular formula | C12H23NO4S2 |
|---|---|
| Molecular weight | 309.5 g/mol |
| IUPAC name | (2R)-3-(tert-butyldisulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PPQRALRLGBAWHD-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSSC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)