CAS 3004614-00-7 is the registry number for 1,1,1,3,3,3-hexafluoro-2-[(3R)-pyrrolidin-3-yl]propan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1,1,1,3,3,3-hexafluoro-2-[(3R)-pyrrolidin-3-yl]propan-2-ol (CAS 3004614-00-7) is a chemical compound with the molecular formula C7H9F6NO and a molecular weight of 237.14 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-[(3R)-pyrrolidin-3-yl]propan-2-ol. InChIKey: NBBGYIJHSRDPHT-SCSAIBSYSA-N.
| Molecular formula | C7H9F6NO |
|---|---|
| Molecular weight | 237.14 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-[(3R)-pyrrolidin-3-yl]propan-2-ol |
| InChIKey | NBBGYIJHSRDPHT-SCSAIBSYSA-N |
| SMILES | C1CNC[C@@H]1C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)