CAS 3004676-87-0 is the registry number for FXR/CES2 modulator 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]phenoxy]acetic acid (CAS 3004676-87-0) is a chemical compound with the molecular formula C27H21Cl2NO5 and a molecular weight of 510.4 g/mol. IUPAC name: 2-[4-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]phenoxy]acetic acid. InChIKey: RPKZEWFQFHBIQI-UHFFFAOYSA-N.
| Molecular formula | C27H21Cl2NO5 |
|---|---|
| Molecular weight | 510.4 g/mol |
| IUPAC name | 2-[4-[4-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]phenyl]phenoxy]acetic acid |
| InChIKey | RPKZEWFQFHBIQI-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C(=NO2)C3=C(C=CC=C3Cl)Cl)COC4=CC=C(C=C4)C5=CC=C(C=C5)OCC(=O)O |
Computed by PubChem (NCBI)