CAS 3005-97-8 is the registry number for Liothyronine Ethyl Ester. Offered by: Mikromol. Available pack sizes: 25mg.
Ethyl (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoate (CAS 3005-97-8) is a chemical compound with the molecular formula C17H16I3NO4 and a molecular weight of 679.03 g/mol. IUPAC name: ethyl (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoate. InChIKey: XVBVEMSFGOEYPM-AWEZNQCLSA-N.
| Molecular formula | C17H16I3NO4 |
|---|---|
| Molecular weight | 679.03 g/mol |
| IUPAC name | ethyl (2S)-2-amino-3-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]propanoate |
| InChIKey | XVBVEMSFGOEYPM-AWEZNQCLSA-N |
| SMILES | CCOC(=O)[C@H](CC1=CC(=C(C(=C1)I)OC2=CC(=C(C=C2)O)I)I)N |
Computed by PubChem (NCBI)