CAS 300551-49-9 appears in our catalog under these names: CP-642931/ 99.94% (existing batch purity), Sorbitol dehydrogenase–IN–1, CP-642931, 98%, 98%, Sorbitol dehydrogenase-IN-1, 98.70%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 10 mg.
(1R)-1-[4-[(2R,6S)-4-(4,6-dimethyl-1,3,5-triazin-2-yl)-2,6-dimethylpiperazin-1-yl]pyrimidin-2-yl]ethanol (CAS 300551-49-9) is a chemical compound with the molecular formula C17H25N7O and a molecular weight of 343.4 g/mol. IUPAC name: (1R)-1-[4-[(2R,6S)-4-(4,6-dimethyl-1,3,5-triazin-2-yl)-2,6-dimethylpiperazin-1-yl]pyrimidin-2-yl]ethanol. InChIKey: FTEQMUXMWCGJAF-GRYCIOLGSA-N.
| Molecular formula | C17H25N7O |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (1R)-1-[4-[(2R,6S)-4-(4,6-dimethyl-1,3,5-triazin-2-yl)-2,6-dimethylpiperazin-1-yl]pyrimidin-2-yl]ethanol |
| InChIKey | FTEQMUXMWCGJAF-GRYCIOLGSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1C2=NC(=NC=C2)[C@@H](C)O)C)C3=NC(=NC(=N3)C)C |
Computed by PubChem (NCBI)