CAS 300571-21-5 is the registry number for Methyl 2-methanesulfonyl-4-(trifluoromethyl)benzoate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
Methyl 2-methylsulfonyl-4-(trifluoromethyl)benzoate (CAS 300571-21-5) is a chemical compound with the molecular formula C10H9F3O4S and a molecular weight of 282.24 g/mol. IUPAC name: methyl 2-methylsulfonyl-4-(trifluoromethyl)benzoate. InChIKey: UBYCAYQBVIHEER-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O4S |
|---|---|
| Molecular weight | 282.24 g/mol |
| IUPAC name | methyl 2-methylsulfonyl-4-(trifluoromethyl)benzoate |
| InChIKey | UBYCAYQBVIHEER-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(F)(F)F)S(=O)(=O)C |
Computed by PubChem (NCBI)