Products 300577-17-7
CAS 300577-17-7 is the registry number for L-Dihydroorotic Acid-D3, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
(4S)-4,5,5-trideuterio-2,6-dioxo-1,3-diazinane-4-carboxylic acid (CAS 300577-17-7) is a chemical compound with the molecular formula C5H6N2O4 and a molecular weight of 161.13 g/mol. IUPAC name: (4S)-4,5,5-trideuterio-2,6-dioxo-1,3-diazinane-4-carboxylic acid. InChIKey: UFIVEPVSAGBUSI-RBXBQAPRSA-N.
| Molecular formula | C5H6N2O4 |
|---|---|
| Molecular weight | 161.13 g/mol |
| IUPAC name | (4S)-4,5,5-trideuterio-2,6-dioxo-1,3-diazinane-4-carboxylic acid |
| InChIKey | UFIVEPVSAGBUSI-RBXBQAPRSA-N |
| SMILES | [2H][C@]1(C(C(=O)NC(=O)N1)([2H])[2H])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
L-Dihydroorotic Acid-D3