CAS 3005979-40-5 is the registry number for AR antagonist 11. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3aR,4R,11cR)-4-(4-chlorophenyl)-2,3,3a,4,5,11c-hexahydrofuro[2,3-a][4,7]phenanthroline (CAS 3005979-40-5) is a chemical compound with the molecular formula C20H17ClN2O and a molecular weight of 336.8 g/mol. IUPAC name: (3aR,4R,11cR)-4-(4-chlorophenyl)-2,3,3a,4,5,11c-hexahydrofuro[2,3-a][4,7]phenanthroline. InChIKey: NNYAXDQYOIZHLB-UIAACRFSSA-N.
| Molecular formula | C20H17ClN2O |
|---|---|
| Molecular weight | 336.8 g/mol |
| IUPAC name | (3aR,4R,11cR)-4-(4-chlorophenyl)-2,3,3a,4,5,11c-hexahydrofuro[2,3-a][4,7]phenanthroline |
| InChIKey | NNYAXDQYOIZHLB-UIAACRFSSA-N |
| SMILES | C1CO[C@@H]2[C@H]1[C@@H](NC3=C2C4=C(C=C3)N=CC=C4)C5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)