CAS 3006-15-3 appears in our catalog under these names: Dihexyl sodium sulfosuccinate, 80% aqueous solution, 1,4-Bis(hexyloxy)-1,4-dioxobutane-2-sulfonic acid, sodium salt 98+%, 1,4-Bis(hexyloxy)-1,4-dioxobutane-2-sulfonic acid, sodium salt, 98+%, 98+%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,25kg, 0,5kg, 1kg, 2kg, 5kg, 100mg, 250mg, 1g.
Sodium 1,4-dihexoxy-1,4-dioxobutane-2-sulfonate (CAS 3006-15-3) is a chemical compound with the molecular formula C16H29NaO7S and a molecular weight of 388.5 g/mol. IUPAC name: sodium 1,4-dihexoxy-1,4-dioxobutane-2-sulfonate. InChIKey: WVFDILODTFJAPA-UHFFFAOYSA-M.
| Molecular formula | C16H29NaO7S |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | sodium 1,4-dihexoxy-1,4-dioxobutane-2-sulfonate |
| InChIKey | WVFDILODTFJAPA-UHFFFAOYSA-M |
| SMILES | CCCCCCOC(=O)CC(C(=O)OCCCCCC)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)