CAS 30060-95-8 appears in our catalog under these names: 8-Chloro-5-methoxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, 8-Chloro-5-methoxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(8-chloro-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-methylazanium chloride (CAS 30060-95-8) is a chemical compound with the molecular formula C12H17Cl2NO and a molecular weight of 262.17 g/mol. IUPAC name: (8-chloro-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-methylazanium chloride. InChIKey: PAJIFHNCQNJSEG-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2NO |
|---|---|
| Molecular weight | 262.17 g/mol |
| IUPAC name | (8-chloro-5-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)-methylazanium chloride |
| InChIKey | PAJIFHNCQNJSEG-UHFFFAOYSA-N |
| SMILES | C[NH2+]C1CCCC2=C(C=CC(=C12)Cl)OC.[Cl-] |
Computed by PubChem (NCBI)