CAS 300676-07-7 is the registry number for 1,3-Dimethyl 5-(3-(2-chloroacetyl)-2,5-dimethyl-1H-pyrrol-1-yl)benzene-1,3-dicarboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Dimethyl 5-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate (CAS 300676-07-7) is a chemical compound with the molecular formula C18H18ClNO5 and a molecular weight of 363.8 g/mol. IUPAC name: dimethyl 5-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate. InChIKey: AVWZOYDPDONNBX-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO5 |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | dimethyl 5-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate |
| InChIKey | AVWZOYDPDONNBX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC(=CC(=C2)C(=O)OC)C(=O)OC)C)C(=O)CCl |
Computed by PubChem (NCBI)