CAS 300727-15-5 appears in our catalog under these names: 2-Chloro-n-(3-methyl-1-phenyl-1h-pyrazol-5-yl)acetamide, 95%, 2-Chloro-N-(3-methyl-1-phenyl-1H-pyrazol-5-yl)acetamide. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 100mg, 5g, 250mg, 1g, 10g, 500mg.
2-chloro-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide (CAS 300727-15-5) is a chemical compound with the molecular formula C12H12ClN3O and a molecular weight of 249.69 g/mol. IUPAC name: 2-chloro-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide. InChIKey: WITNPEBNOYWOGB-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | 2-chloro-N-(5-methyl-2-phenylpyrazol-3-yl)acetamide |
| InChIKey | WITNPEBNOYWOGB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)NC(=O)CCl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)