CAS 3008-31-9 is the registry number for p-Perfluoroterphenyl. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 25mg, 50mg, 250mg.
1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]benzene (CAS 3008-31-9) is a chemical compound with the molecular formula C18F14 and a molecular weight of 482.2 g/mol. IUPAC name: 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]benzene. InChIKey: OZQSEPKJIUMPRU-UHFFFAOYSA-N.
| Molecular formula | C18F14 |
|---|---|
| Molecular weight | 482.2 g/mol |
| IUPAC name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]benzene |
| InChIKey | OZQSEPKJIUMPRU-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)C2=C(C(=C(C(=C2F)F)F)F)F)F)F)C3=C(C(=C(C(=C3F)F)F)F)F |
Computed by PubChem (NCBI)