CAS 300809-71-6 appears in our catalog under these names: 4-(1,3-Benzothiazol-2-ylsulfanyl)-3-chloroaniline, 95%, KRAS inhibitor–9, KRAS inhibitor-9/ 99.94% (existing batch purity), Kras inhibitor-9, KRAS inhibitor-9 98%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 200mg.
4-(1,3-benzothiazol-2-ylsulfanyl)-3-chloroaniline (CAS 300809-71-6) is a chemical compound with the molecular formula C13H9ClN2S2 and a molecular weight of 292.8 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-ylsulfanyl)-3-chloroaniline. InChIKey: DTSNLMOLTVGCGZ-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2S2 |
|---|---|
| Molecular weight | 292.8 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-ylsulfanyl)-3-chloroaniline |
| InChIKey | DTSNLMOLTVGCGZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SC3=C(C=C(C=C3)N)Cl |
Computed by PubChem (NCBI)