CAS 300815-04-7 appears in our catalog under these names: Apcin, 98%, Apcin/ 96.74% (existing batch purity), Apcin, Apcin, >95.0%(HPLC)(qNMR), Apcin 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 250mg, 100mg, 1g, 1mg, 2mg, 5mg, 10mg, 25mg.
2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]carbamate (CAS 300815-04-7) is a chemical compound with the molecular formula C13H14Cl3N7O4 and a molecular weight of 438.6 g/mol. IUPAC name: 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]carbamate. InChIKey: ZEXHXVOGJFGTRX-UHFFFAOYSA-N.
| Molecular formula | C13H14Cl3N7O4 |
|---|---|
| Molecular weight | 438.6 g/mol |
| IUPAC name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl N-[2,2,2-trichloro-1-(pyrimidin-2-ylamino)ethyl]carbamate |
| InChIKey | ZEXHXVOGJFGTRX-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1CCOC(=O)NC(C(Cl)(Cl)Cl)NC2=NC=CC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)