Products 3008229-57-7
CAS 3008229-57-7 is the registry number for methyl 4-fluoro-2-azabicyclo[2.1.1]hexane-1-carboxylate hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 4-fluoro-2-azabicyclo[2.1.1]hexane-1-carboxylate;hydrochloride (CAS 3008229-57-7) is a chemical compound with the molecular formula C7H11ClFNO2 and a molecular weight of 195.62 g/mol. IUPAC name: methyl 4-fluoro-2-azabicyclo[2.1.1]hexane-1-carboxylate;hydrochloride. InChIKey: YQVSYPVSNFRZSY-UHFFFAOYSA-N.
| Molecular formula | C7H11ClFNO2 |
|---|---|
| Molecular weight | 195.62 g/mol |
| IUPAC name | methyl 4-fluoro-2-azabicyclo[2.1.1]hexane-1-carboxylate;hydrochloride |
| InChIKey | YQVSYPVSNFRZSY-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(CN2)F.Cl |
Computed by PubChem (NCBI)