Products 30084-91-4

CAS 30084-91-4 appears in our catalog under these names: Indan-5-carbaldehyde, 95%, 2,3-Dihydro-1H-indene-5-carbaldehyde 98%, Indan-5-carboxaldehyde, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-indene-5-carbaldehyde (CAS 30084-91-4) is a chemical compound with the molecular formula C10H10O and a molecular weight of 146.19 g/mol. IUPAC name: 2,3-dihydro-1H-indene-5-carbaldehyde. InChIKey: YNGGRNROMJXLCP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O
Molecular weight146.19 g/mol
IUPAC name2,3-dihydro-1H-indene-5-carbaldehyde
InChIKeyYNGGRNROMJXLCP-UHFFFAOYSA-N
SMILESC1CC2=C(C1)C=C(C=C2)C=O

Computed by PubChem (NCBI)