Products 300842-59-5
CAS 300842-59-5 is the registry number for NVP-AAD777. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[3,4-bis(trifluoromethyl)phenyl]-4-(pyridin-4-ylmethyl)phthalazin-1-amine (CAS 300842-59-5) is a chemical compound with the molecular formula C22H14F6N4 and a molecular weight of 448.4 g/mol. IUPAC name: N-[3,4-bis(trifluoromethyl)phenyl]-4-(pyridin-4-ylmethyl)phthalazin-1-amine. InChIKey: BSIYFOACHNHUPJ-UHFFFAOYSA-N.
| Molecular formula | C22H14F6N4 |
|---|---|
| Molecular weight | 448.4 g/mol |
| IUPAC name | N-[3,4-bis(trifluoromethyl)phenyl]-4-(pyridin-4-ylmethyl)phthalazin-1-amine |
| InChIKey | BSIYFOACHNHUPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2NC3=CC(=C(C=C3)C(F)(F)F)C(F)(F)F)CC4=CC=NC=C4 |
Computed by PubChem (NCBI)