Products 300843-20-3
CAS 300843-20-3 is the registry number for Ketopynalin. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(4-chloroanilino)phthalazin-1-yl]-pyridin-4-ylmethanone (CAS 300843-20-3) is a chemical compound with the molecular formula C20H13ClN4O and a molecular weight of 360.8 g/mol. IUPAC name: [4-(4-chloroanilino)phthalazin-1-yl]-pyridin-4-ylmethanone. InChIKey: PNQWLLMVBJXXNJ-UHFFFAOYSA-N.
| Molecular formula | C20H13ClN4O |
|---|---|
| Molecular weight | 360.8 g/mol |
| IUPAC name | [4-(4-chloroanilino)phthalazin-1-yl]-pyridin-4-ylmethanone |
| InChIKey | PNQWLLMVBJXXNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2NC3=CC=C(C=C3)Cl)C(=O)C4=CC=NC=C4 |
Computed by PubChem (NCBI)