Products 300843-21-4
CAS 300843-21-4 is the registry number for ZK-261557. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(4-chloroanilino)phthalazin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanol (CAS 300843-21-4) is a chemical compound with the molecular formula C20H15ClN4O2 and a molecular weight of 378.8 g/mol. IUPAC name: [4-(4-chloroanilino)phthalazin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanol. InChIKey: KAODZYLCWYKJKL-UHFFFAOYSA-N.
| Molecular formula | C20H15ClN4O2 |
|---|---|
| Molecular weight | 378.8 g/mol |
| IUPAC name | [4-(4-chloroanilino)phthalazin-1-yl]-(1-oxidopyridin-1-ium-4-yl)methanol |
| InChIKey | KAODZYLCWYKJKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2NC3=CC=C(C=C3)Cl)C(C4=CC=[N+](C=C4)[O-])O |
Computed by PubChem (NCBI)