CAS 3008541-79-2 appears in our catalog under these names: N–Undecanoylglycine–d2, N-Undecanoylglycine-d2, 95.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 10 mg, 5 mg.
2,2-dideuterio-2-(undecanoylamino)acetic acid (CAS 3008541-79-2) is a chemical compound with the molecular formula C13H25NO3 and a molecular weight of 245.35 g/mol. IUPAC name: 2,2-dideuterio-2-(undecanoylamino)acetic acid. InChIKey: HEUQYIQQCNOXOG-ZWGOZCLVSA-N.
| Molecular formula | C13H25NO3 |
|---|---|
| Molecular weight | 245.35 g/mol |
| IUPAC name | 2,2-dideuterio-2-(undecanoylamino)acetic acid |
| InChIKey | HEUQYIQQCNOXOG-ZWGOZCLVSA-N |
| SMILES | [2H]C([2H])(C(=O)O)NC(=O)CCCCCCCCCC |
Computed by PubChem (NCBI)