CAS 30093-29-9 appears in our catalog under these names: Tetraethylammonium trifluoroacetate, 96%, Tetraethylammonium trifluoroacetate, Tetraethylammonium trifluoroacetate 98%, TETRAETHYLAMMONIUM TRIFLUOROACETATE, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 100g, 25g, 10g, 5g.
Tetraethylazanium;2,2,2-trifluoroacetate (CAS 30093-29-9) is a chemical compound with the molecular formula C10H20F3NO2 and a molecular weight of 243.27 g/mol. IUPAC name: tetraethylazanium;2,2,2-trifluoroacetate. InChIKey: SBOOKGHQWGEWCB-UHFFFAOYSA-M.
| Molecular formula | C10H20F3NO2 |
|---|---|
| Molecular weight | 243.27 g/mol |
| IUPAC name | tetraethylazanium;2,2,2-trifluoroacetate |
| InChIKey | SBOOKGHQWGEWCB-UHFFFAOYSA-M |
| SMILES | CC[N+](CC)(CC)CC.C(=O)(C(F)(F)F)[O-] |
Computed by PubChem (NCBI)