CAS 30095-55-7 is the registry number for 1-(4-amino-3,5-dibromophenyl)-2-bromoethanone. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-amino-3,5-dibromophenyl)-2-bromoethanone (CAS 30095-55-7) is a chemical compound with the molecular formula C8H6Br3NO and a molecular weight of 371.85 g/mol. IUPAC name: 1-(4-amino-3,5-dibromophenyl)-2-bromoethanone. InChIKey: HAMHABGUPISDGT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br3NO |
|---|---|
| Molecular weight | 371.85 g/mol |
| IUPAC name | 1-(4-amino-3,5-dibromophenyl)-2-bromoethanone |
| InChIKey | HAMHABGUPISDGT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)C(=O)CBr |
Computed by PubChem (NCBI)