CAS 3010-57-9 appears in our catalog under these names: 4-Dimethylamino-4'-methylazobenzene, >95% (HPLC), N,N-Dimethyl-4-(p-tolyldiazenyl)aniline, 98%. Offered by: TRC, AmBeed. Available pack sizes: 100mg, 500mg, 50mg, 1g, 250mg.
N,N-dimethyl-4-[(4-methylphenyl)diazenyl]aniline (CAS 3010-57-9) is a chemical compound with the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. IUPAC name: N,N-dimethyl-4-[(4-methylphenyl)diazenyl]aniline. InChIKey: IPIZWPBCCYXHDW-UHFFFAOYSA-N.
| Molecular formula | C15H17N3 |
|---|---|
| Molecular weight | 239.32 g/mol |
| IUPAC name | N,N-dimethyl-4-[(4-methylphenyl)diazenyl]aniline |
| InChIKey | IPIZWPBCCYXHDW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N=NC2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)