CAS 3010273-13-6 is the registry number for ATR-IN-30. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl 4-[4-[5-amino-6-(phenylcarbamoyl)pyrazin-2-yl]benzoyl]piperazine-1-carboxylate (CAS 3010273-13-6) is a chemical compound with the molecular formula C27H30N6O4 and a molecular weight of 502.6 g/mol. IUPAC name: tert-butyl 4-[4-[5-amino-6-(phenylcarbamoyl)pyrazin-2-yl]benzoyl]piperazine-1-carboxylate. InChIKey: QFBPYCJMZOALRX-UHFFFAOYSA-N.
| Molecular formula | C27H30N6O4 |
|---|---|
| Molecular weight | 502.6 g/mol |
| IUPAC name | tert-butyl 4-[4-[5-amino-6-(phenylcarbamoyl)pyrazin-2-yl]benzoyl]piperazine-1-carboxylate |
| InChIKey | QFBPYCJMZOALRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(=O)C2=CC=C(C=C2)C3=CN=C(C(=N3)C(=O)NC4=CC=CC=C4)N |
Computed by PubChem (NCBI)