CAS 301192-96-1 is the registry number for 2-(Azidomethyl)imidazo(1,2-a)pyrimidine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(azidomethyl)imidazo[1,2-a]pyrimidine (CAS 301192-96-1) is a chemical compound with the molecular formula C7H6N6 and a molecular weight of 174.16 g/mol. IUPAC name: 2-(azidomethyl)imidazo[1,2-a]pyrimidine. InChIKey: DOQHANASDOULKX-UHFFFAOYSA-N.
| Molecular formula | C7H6N6 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 2-(azidomethyl)imidazo[1,2-a]pyrimidine |
| InChIKey | DOQHANASDOULKX-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2N=C1)CN=[N+]=[N-] |
Computed by PubChem (NCBI)