CAS 301196-85-0 is the registry number for 2-((tert-Butoxycarbonyl)amino)-2-(4-(trifluoromethoxy)phenyl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-(trifluoromethoxy)phenyl]acetic acid (CAS 301196-85-0) is a chemical compound with the molecular formula C14H16F3NO5 and a molecular weight of 335.28 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-(trifluoromethoxy)phenyl]acetic acid. InChIKey: ACVWOMTWTVMAES-UHFFFAOYSA-N.
| Molecular formula | C14H16F3NO5 |
|---|---|
| Molecular weight | 335.28 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[4-(trifluoromethoxy)phenyl]acetic acid |
| InChIKey | ACVWOMTWTVMAES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=C(C=C1)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)