CAS 301201-62-7 is the registry number for 2-((4-Fluorophenyl)methylene)-N-methylhydrazinecarbothioamide. Offered by: TRC. Available pack sizes: 1g.
1-[(E)-(4-fluorophenyl)methylideneamino]-3-methylthiourea (CAS 301201-62-7) is a chemical compound with the molecular formula C9H10FN3S and a molecular weight of 211.26 g/mol. IUPAC name: 1-[(E)-(4-fluorophenyl)methylideneamino]-3-methylthiourea. InChIKey: GNNAFHBQPPWCKK-WUXMJOGZSA-N.
| Molecular formula | C9H10FN3S |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 1-[(E)-(4-fluorophenyl)methylideneamino]-3-methylthiourea |
| InChIKey | GNNAFHBQPPWCKK-WUXMJOGZSA-N |
| SMILES | CNC(=S)N/N=C/C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)