Products 301211-35-8
CAS 301211-35-8 is the registry number for HCV-IN-45. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-N-(4-nitrophenyl)-4-N-pentyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (CAS 301211-35-8) is a chemical compound with the molecular formula C16H19F3N6O3 and a molecular weight of 400.36 g/mol. IUPAC name: 2-N-(4-nitrophenyl)-4-N-pentyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine. InChIKey: ZKEGXILVFBAJOX-UHFFFAOYSA-N.
| Molecular formula | C16H19F3N6O3 |
|---|---|
| Molecular weight | 400.36 g/mol |
| IUPAC name | 2-N-(4-nitrophenyl)-4-N-pentyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| InChIKey | ZKEGXILVFBAJOX-UHFFFAOYSA-N |
| SMILES | CCCCCNC1=NC(=NC(=N1)OCC(F)(F)F)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)