CAS 3013-05-6 is the registry number for Sodium 1-methyl-1H-benzo(d)imidazole-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Sodium 1-methylbenzimidazole-2-carboxylate (CAS 3013-05-6) is a chemical compound with the molecular formula C9H7N2NaO2 and a molecular weight of 198.15 g/mol. IUPAC name: sodium 1-methylbenzimidazole-2-carboxylate. InChIKey: RGAQOUZWLPAPHM-UHFFFAOYSA-M.
| Molecular formula | C9H7N2NaO2 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | sodium 1-methylbenzimidazole-2-carboxylate |
| InChIKey | RGAQOUZWLPAPHM-UHFFFAOYSA-M |
| SMILES | CN1C2=CC=CC=C2N=C1C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)