Products 301313-42-8
CAS 301313-42-8 is the registry number for Sirt1/2-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3-chloro-4-hydroxynaphthalen-1-yl)-4-methoxybenzenesulfonamide (CAS 301313-42-8) is a chemical compound with the molecular formula C17H14ClNO4S and a molecular weight of 363.8 g/mol. IUPAC name: N-(3-chloro-4-hydroxynaphthalen-1-yl)-4-methoxybenzenesulfonamide. InChIKey: PBHNALRVEVSVQD-UHFFFAOYSA-N.
| Molecular formula | C17H14ClNO4S |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | N-(3-chloro-4-hydroxynaphthalen-1-yl)-4-methoxybenzenesulfonamide |
| InChIKey | PBHNALRVEVSVQD-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C3=CC=CC=C32)O)Cl |
Computed by PubChem (NCBI)