Products 301357-87-9
CAS 301357-87-9 is the registry number for BMD4503-2, 99.21%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 5 mg, 10mM/1mL, 10 mg.
N-[4-[[3-(naphthalen-1-ylamino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide (CAS 301357-87-9) is a chemical compound with the molecular formula C26H21N5O3S and a molecular weight of 483.5 g/mol. IUPAC name: N-[4-[[3-(naphthalen-1-ylamino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide. InChIKey: NCZQTIRXSCXOKR-UHFFFAOYSA-N.
| Molecular formula | C26H21N5O3S |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | N-[4-[[3-(naphthalen-1-ylamino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
| InChIKey | NCZQTIRXSCXOKR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC2=NC3=CC=CC=C3N=C2NC4=CC=CC5=CC=CC=C54 |
Computed by PubChem (NCBI)