CAS 301359-91-1 appears in our catalog under these names: Eif-2α inhibitor II, sal003, eIF-2╬▒ Inhibitor II, Sal003 1PC X 5MG. Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg.
(E)-3-phenyl-N-[2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide (CAS 301359-91-1) is a chemical compound with the molecular formula C18H15Cl4N3OS and a molecular weight of 463.2 g/mol. IUPAC name: (E)-3-phenyl-N-[2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide. InChIKey: TVNBASWNLOIQML-IZZDOVSWSA-N.
| Molecular formula | C18H15Cl4N3OS |
|---|---|
| Molecular weight | 463.2 g/mol |
| IUPAC name | (E)-3-phenyl-N-[2,2,2-trichloro-1-[(4-chlorophenyl)carbamothioylamino]ethyl]prop-2-enamide |
| InChIKey | TVNBASWNLOIQML-IZZDOVSWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC(C(Cl)(Cl)Cl)NC(=S)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)