CAS 3015-66-5 is the registry number for Dibutyl 2,3,4,5-Tetrachlorophthalate. Offered by: TRC. Available pack sizes: 500mg, 5g.
Dibutyl 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate (CAS 3015-66-5) is a chemical compound with the molecular formula C16H18Cl4O4 and a molecular weight of 416.1 g/mol. IUPAC name: dibutyl 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate. InChIKey: CZYWSKLOYGOGRT-UHFFFAOYSA-N.
| Molecular formula | C16H18Cl4O4 |
|---|---|
| Molecular weight | 416.1 g/mol |
| IUPAC name | dibutyl 3,4,5,6-tetrachlorobenzene-1,2-dicarboxylate |
| InChIKey | CZYWSKLOYGOGRT-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)C(=O)OCCCC |
Computed by PubChem (NCBI)